C22H33NO — CID 57041708
7-pyridin-3-ylheptadeca-12,16-dien-5-one (PubChem CID 57041708) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is 7-pyridin-3-ylheptadeca-12,16-dien-5-one.
| Compound Name | 7-pyridin-3-ylheptadeca-12,16-dien-5-one |
|---|---|
| PubChem CID | 57041708 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | 7-pyridin-3-ylheptadeca-12,16-dien-5-one |
| SMILES | C=CCCC=CCCCCC(CC(=O)CCCC)c1cccnc1 |
| InChI | InChI=1S/C22H33NO/c1-3-5-7-8-9-10-11-12-14-20(18-22(24)16-6-4-2)21-15-13-17-23-19-21/h3,8-9,13,15,17,19-20H,1,4-7,10-12,14,16,18H2,2H3 |
| InChIKey | JABHCRVFEIAKEZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|