C12H21N3S — CID 107012859
1-(2-methyl-1,3-thiazol-4-yl)oct-7-enylhydrazine (PubChem CID 107012859) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-4-yl)oct-7-enylhydrazine.
| Compound Name | 1-(2-methyl-1,3-thiazol-4-yl)oct-7-enylhydrazine |
|---|---|
| PubChem CID | 107012859 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-4-yl)oct-7-enylhydrazine |
| SMILES | C=CCCCCCC(NN)c1csc(C)n1 |
| InChI | InChI=1S/C12H21N3S/c1-3-4-5-6-7-8-11(15-13)12-9-16-10(2)14-12/h3,9,11,15H,1,4-8,13H2,2H3 |
| InChIKey | GXOCAYULVVRKKW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|