C10H15NOS — CID 105102094
1-(2-methyl-1,3-thiazol-4-yl)hex-5-en-1-ol (PubChem CID 105102094) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-4-yl)hex-5-en-1-ol.
| Compound Name | 1-(2-methyl-1,3-thiazol-4-yl)hex-5-en-1-ol |
|---|---|
| PubChem CID | 105102094 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-4-yl)hex-5-en-1-ol |
| SMILES | C=CCCCC(O)c1csc(C)n1 |
| InChI | InChI=1S/C10H15NOS/c1-3-4-5-6-10(12)9-7-13-8(2)11-9/h3,7,10,12H,1,4-6H2,2H3 |
| InChIKey | KSVZBYZJJNHZLD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|