C7H12N2OS — CID 124505318
(1R,2S)-1-amino-1-(2-methyl-1,3-thiazol-4-yl)propan-2-ol (PubChem CID 124505318) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(2-methyl-1,3-thiazol-4-yl)propan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(2-methyl-1,3-thiazol-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 124505318 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (1R,2S)-1-amino-1-(2-methyl-1,3-thiazol-4-yl)propan-2-ol |
| SMILES | Cc1nc([C@@H](N)[C@H](C)O)cs1 |
| InChI | InChI=1S/C7H12N2OS/c1-4(10)7(8)6-3-11-5(2)9-6/h3-4,7,10H,8H2,1-2H3/t4-,7-/m0/s1 |
| InChIKey | VTSLCFNGVMRGIP-FFWSUHOLSA-N |
| XLogP | 0.83 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |