About (1S)-1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine
(1S)-1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine (PubChem CID 55296429) has the molecular formula C6H11N3S
and a molecular weight of 157.24 g/mol. Its IUPAC name is (1S)-1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine.
Analyze (1S)-1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine?
The IUPAC name of (1S)-1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine (CID 55296429) is (1S)-1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine.
What is the SMILES notation for (1S)-1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine?
The canonical SMILES for (1S)-1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine is Cc1nc([C@@H](N)CN)cs1.
What is the InChIKey of (1S)-1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine?
The InChIKey is UZNHKDKVSKTIHY-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H11N3S/c1-4-9-6(3-10-4)5(8)2-7/h3,5H,2,7-8H2,1H3/t5-/m0/s1.
What are the key properties of (1S)-1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine?
(1S)-1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine has a molecular weight of 157.24 g/mol, XLogP of 0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 55296429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).