C10H14N2S — CID 105179634
1-(2-methyl-1,3-thiazol-4-yl)hex-5-yn-1-amine (PubChem CID 105179634) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-4-yl)hex-5-yn-1-amine.
| Compound Name | 1-(2-methyl-1,3-thiazol-4-yl)hex-5-yn-1-amine |
|---|---|
| PubChem CID | 105179634 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-4-yl)hex-5-yn-1-amine |
| SMILES | C#CCCCC(N)c1csc(C)n1 |
| InChI | InChI=1S/C10H14N2S/c1-3-4-5-6-9(11)10-7-13-8(2)12-10/h1,7,9H,4-6,11H2,2H3 |
| InChIKey | YBYFDBAGBZJTNE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|