C12H19N3 — CID 105179598
1-(1,3,5-trimethylpyrazol-4-yl)hex-5-yn-1-amine (PubChem CID 105179598) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(1,3,5-trimethylpyrazol-4-yl)hex-5-yn-1-amine.
| Compound Name | 1-(1,3,5-trimethylpyrazol-4-yl)hex-5-yn-1-amine |
|---|---|
| PubChem CID | 105179598 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1-(1,3,5-trimethylpyrazol-4-yl)hex-5-yn-1-amine |
| SMILES | C#CCCCC(N)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C12H19N3/c1-5-6-7-8-11(13)12-9(2)14-15(4)10(12)3/h1,11H,6-8,13H2,2-4H3 |
| InChIKey | AGXMQADVIBOEDU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|