C11H18N4 — CID 105307847
1-(1,3,5-trimethylpyrazol-4-yl)pent-4-ynylhydrazine (PubChem CID 105307847) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(1,3,5-trimethylpyrazol-4-yl)pent-4-ynylhydrazine.
| Compound Name | 1-(1,3,5-trimethylpyrazol-4-yl)pent-4-ynylhydrazine |
|---|---|
| PubChem CID | 105307847 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-(1,3,5-trimethylpyrazol-4-yl)pent-4-ynylhydrazine |
| SMILES | C#CCCC(NN)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C11H18N4/c1-5-6-7-10(13-12)11-8(2)14-15(4)9(11)3/h1,10,13H,6-7,12H2,2-4H3 |
| InChIKey | UMVYZMPUDAIWMB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|