C13H24N4O — CID 105314270
[3-(oxolan-2-yl)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine (PubChem CID 105314270) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is [3-(oxolan-2-yl)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine.
| Compound Name | [3-(oxolan-2-yl)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 105314270 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | [3-(oxolan-2-yl)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine |
| SMILES | Cc1nn(C)c(C)c1C(CCC1CCCO1)NN |
| InChI | InChI=1S/C13H24N4O/c1-9-13(10(2)17(3)16-9)12(15-14)7-6-11-5-4-8-18-11/h11-12,15H,4-8,14H2,1-3H3 |
| InChIKey | KDUBCWHTXKXECI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|