C11H19N3O — CID 82834331
1,3,5-trimethyl-N-(oxolan-2-ylmethyl)pyrazol-4-amine (PubChem CID 82834331) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-(oxolan-2-ylmethyl)pyrazol-4-amine.
| Compound Name | 1,3,5-trimethyl-N-(oxolan-2-ylmethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 82834331 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1,3,5-trimethyl-N-(oxolan-2-ylmethyl)pyrazol-4-amine |
| SMILES | Cc1nn(C)c(C)c1NCC1CCCO1 |
| InChI | InChI=1S/C11H19N3O/c1-8-11(9(2)14(3)13-8)12-7-10-5-4-6-15-10/h10,12H,4-7H2,1-3H3 |
| InChIKey | KOPHJNMUQHBQBM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |