C16H30N4O — CID 105314157
[6-(oxolan-2-yl)-1-(1,3,5-trimethylpyrazol-4-yl)hexan-3-yl]hydrazine (PubChem CID 105314157) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is [6-(oxolan-2-yl)-1-(1,3,5-trimethylpyrazol-4-yl)hexan-3-yl]hydrazine.
| Compound Name | [6-(oxolan-2-yl)-1-(1,3,5-trimethylpyrazol-4-yl)hexan-3-yl]hydrazine |
|---|---|
| PubChem CID | 105314157 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | [6-(oxolan-2-yl)-1-(1,3,5-trimethylpyrazol-4-yl)hexan-3-yl]hydrazine |
| SMILES | Cc1nn(C)c(C)c1CCC(CCCC1CCCO1)NN |
| InChI | InChI=1S/C16H30N4O/c1-12-16(13(2)20(3)19-12)10-9-14(18-17)6-4-7-15-8-5-11-21-15/h14-15,18H,4-11,17H2,1-3H3 |
| InChIKey | RAJVYZFCMVFCRM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|