C9H14N2O2S — CID 104862981
ethyl (3S)-3-amino-3-(2-methyl-1,3-thiazol-4-yl)propanoate (PubChem CID 104862981) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(2-methyl-1,3-thiazol-4-yl)propanoate.
| Compound Name | ethyl (3S)-3-amino-3-(2-methyl-1,3-thiazol-4-yl)propanoate |
|---|---|
| PubChem CID | 104862981 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | ethyl (3S)-3-amino-3-(2-methyl-1,3-thiazol-4-yl)propanoate |
| SMILES | CCOC(=O)C[C@H](N)c1csc(C)n1 |
| InChI | InChI=1S/C9H14N2O2S/c1-3-13-9(12)4-7(10)8-5-14-6(2)11-8/h5,7H,3-4,10H2,1-2H3/t7-/m0/s1 |
| InChIKey | DANBMXVUTFEWSA-ZETCQYMHSA-N |
| XLogP | 1.40 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |