C5H5Br2NS — CID 119088205
4-(dibromomethyl)-2-methyl-1,3-thiazole (PubChem CID 119088205) has the molecular formula C5H5Br2NS and a molecular weight of 270.98 g/mol. Its IUPAC name is 4-(dibromomethyl)-2-methyl-1,3-thiazole.
| Compound Name | 4-(dibromomethyl)-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 119088205 |
| Molecular Formula | C5H5Br2NS |
| Molecular Weight | 270.98 g/mol |
| Exact Mass | 268.85 |
| IUPAC Name | 4-(dibromomethyl)-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(C(Br)Br)cs1 |
| InChI | InChI=1S/C5H5Br2NS/c1-3-8-4(2-9-3)5(6)7/h2,5H,1H3 |
| InChIKey | SCZGZXDEZAJOEG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.98 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|