C10H16N2S — CID 130703054
2-methyl-4-(1-pyrrolidin-1-ylethyl)-1,3-thiazole (PubChem CID 130703054) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 2-methyl-4-(1-pyrrolidin-1-ylethyl)-1,3-thiazole.
| Compound Name | 2-methyl-4-(1-pyrrolidin-1-ylethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 130703054 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-methyl-4-(1-pyrrolidin-1-ylethyl)-1,3-thiazole |
| SMILES | Cc1nc(C(C)N2CCCC2)cs1 |
| InChI | InChI=1S/C10H16N2S/c1-8(12-5-3-4-6-12)10-7-13-9(2)11-10/h7-8H,3-6H2,1-2H3 |
| InChIKey | TWGVJHDJTQHRRY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |