C6H8INOS — CID 137495706
2-iodo-2-(2-methyl-1,3-thiazol-4-yl)ethanol (PubChem CID 137495706) has the molecular formula C6H8INOS and a molecular weight of 269.11 g/mol. Its IUPAC name is 2-iodo-2-(2-methyl-1,3-thiazol-4-yl)ethanol.
| Compound Name | 2-iodo-2-(2-methyl-1,3-thiazol-4-yl)ethanol |
|---|---|
| PubChem CID | 137495706 |
| Molecular Formula | C6H8INOS |
| Molecular Weight | 269.11 g/mol |
| Exact Mass | 268.94 |
| IUPAC Name | 2-iodo-2-(2-methyl-1,3-thiazol-4-yl)ethanol |
| SMILES | Cc1nc(C(I)CO)cs1 |
| InChI | InChI=1S/C6H8INOS/c1-4-8-6(3-10-4)5(7)2-9/h3,5,9H,2H2,1H3 |
| InChIKey | YVPLJYILZUGLOX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.11 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|