C8H13NOS — CID 116891275
2-(2-methyl-1,3-thiazol-4-yl)butan-1-ol (PubChem CID 116891275) has the molecular formula C8H13NOS and a molecular weight of 171.26 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)butan-1-ol.
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)butan-1-ol |
|---|---|
| PubChem CID | 116891275 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)butan-1-ol |
| SMILES | CCC(CO)c1csc(C)n1 |
| InChI | InChI=1S/C8H13NOS/c1-3-7(4-10)8-5-11-6(2)9-8/h5,7,10H,3-4H2,1-2H3 |
| InChIKey | TWKYHJHRPZIIIM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |