C7H10N4O2S — CID 174518821
2-(diaminomethylideneamino)-2-(2-methyl-1,3-thiazol-4-yl)acetic acid (PubChem CID 174518821) has the molecular formula C7H10N4O2S and a molecular weight of 214.25 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-2-(2-methyl-1,3-thiazol-4-yl)acetic acid.
| Compound Name | 2-(diaminomethylideneamino)-2-(2-methyl-1,3-thiazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 174518821 |
| Molecular Formula | C7H10N4O2S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-(diaminomethylideneamino)-2-(2-methyl-1,3-thiazol-4-yl)acetic acid |
| SMILES | Cc1nc(C(N=C(N)N)C(=O)O)cs1 |
| InChI | InChI=1S/C7H10N4O2S/c1-3-10-4(2-14-3)5(6(12)13)11-7(8)9/h2,5H,1H3,(H,12,13)(H4,8,9,11) |
| InChIKey | IWTXUTJOFJRDMN-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|