C14H18N2O2S — CID 171383213
(E)-9-(2-ethynyl-1,3-thiazol-4-yl)-N-hydroxynon-8-enamide (PubChem CID 171383213) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is (E)-9-(2-ethynyl-1,3-thiazol-4-yl)-N-hydroxynon-8-enamide.
| Compound Name | (E)-9-(2-ethynyl-1,3-thiazol-4-yl)-N-hydroxynon-8-enamide |
|---|---|
| PubChem CID | 171383213 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (E)-9-(2-ethynyl-1,3-thiazol-4-yl)-N-hydroxynon-8-enamide |
| SMILES | C#Cc1nc(/C=C/CCCCCCC(=O)NO)cs1 |
| InChI | InChI=1S/C14H18N2O2S/c1-2-14-15-12(11-19-14)9-7-5-3-4-6-8-10-13(17)16-18/h1,7,9,11,18H,3-6,8,10H2,(H,16,17)/b9-7+ |
| InChIKey | USDBPPONNDQLEE-VQHVLOKHSA-N |
| XLogP | 2.98 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|