C27H33NO2Si — CID 56996652
(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-pyridin-3-ylpent-4-en-1-ol (PubChem CID 56996652) has the molecular formula C27H33NO2Si and a molecular weight of 431.65 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-pyridin-3-ylpent-4-en-1-ol.
| Compound Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-pyridin-3-ylpent-4-en-1-ol |
|---|---|
| PubChem CID | 56996652 |
| Molecular Formula | C27H33NO2Si |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-pyridin-3-ylpent-4-en-1-ol |
| SMILES | CC(=Cc1cccnc1)[C@H](CCO)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H33NO2Si/c1-22(20-23-12-11-18-28-21-23)26(17-19-29)30-31(27(2,3)4,24-13-7-5-8-14-24)25-15-9-6-10-16-25/h5-16,18,20-21,26,29H,17,19H2,1-4H3/t26-/m0/s1 |
| InChIKey | CWZDSMCMHGRNTG-SANMLTNESA-N |
| XLogP | 4.81 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|