C33H47NO2Si2 — CID 68947226
tert-butyl-[(E,3S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1-pyridin-4-ylpent-1-en-3-yl]oxy-diphenylsilane (PubChem CID 68947226) has the molecular formula C33H47NO2Si2 and a molecular weight of 545.92 g/mol. Its IUPAC name is tert-butyl-[(E,3S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1-pyridin-4-ylpent-1-en-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(E,3S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1-pyridin-4-ylpent-1-en-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 68947226 |
| Molecular Formula | C33H47NO2Si2 |
| Molecular Weight | 545.92 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | tert-butyl-[(E,3S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1-pyridin-4-ylpent-1-en-3-yl]oxy-diphenylsilane |
| SMILES | C/C(=C\c1ccncc1)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H47NO2Si2/c1-27(26-28-20-23-34-24-21-28)31(22-25-35-37(8,9)32(2,3)4)36-38(33(5,6)7,29-16-12-10-13-17-29)30-18-14-11-15-19-30/h10-21,23-24,26,31H,22,25H2,1-9H3/b27-26+/t31-/m0/s1 |
| InChIKey | PQZGTIOPYRNQNM-SZDFBCEPSA-N |
| XLogP | 7.84 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.92 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|