C45H47INOPSi — CID 173080426
[(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-pyridin-2-ylpent-4-enyl]-triphenylphosphanium iodide (PubChem CID 173080426) has the molecular formula C45H47INOPSi and a molecular weight of 803.84 g/mol. Its IUPAC name is [(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-pyridin-2-ylpent-4-enyl]-triphenylphosphanium iodide.
| Compound Name | [(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-pyridin-2-ylpent-4-enyl]-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 173080426 |
| Molecular Formula | C45H47INOPSi |
| Molecular Weight | 803.84 g/mol |
| Exact Mass | 803.22 |
| IUPAC Name | [(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-pyridin-2-ylpent-4-enyl]-triphenylphosphanium iodide |
| SMILES | CC(=Cc1ccccn1)[C@H](CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.[I-] |
| InChI | InChI=1S/C45H47NOPSi.HI/c1-37(36-38-22-20-21-34-46-38)44(47-49(45(2,3)4,42-29-16-8-17-30-42)43-31-18-9-19-32-43)33-35-48(39-23-10-5-11-24-39,40-25-12-6-13-26-40)41-27-14-7-15-28-41;/h5-32,34,36,44H,33,35H2,1-4H3;1H/q+1;/p-1/t44-;/m0./s1 |
| InChIKey | ZBOBIQVOFJDTQA-OXRPNXAASA-M |
| XLogP | 5.82 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.84 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|