C33H37NOSi — CID 101230037
tert-butyl-[(E)-4-(2-methylphenyl)-5-pyridin-2-ylpent-4-enoxy]-diphenylsilane (PubChem CID 101230037) has the molecular formula C33H37NOSi and a molecular weight of 491.75 g/mol. Its IUPAC name is tert-butyl-[(E)-4-(2-methylphenyl)-5-pyridin-2-ylpent-4-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-4-(2-methylphenyl)-5-pyridin-2-ylpent-4-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101230037 |
| Molecular Formula | C33H37NOSi |
| Molecular Weight | 491.75 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | tert-butyl-[(E)-4-(2-methylphenyl)-5-pyridin-2-ylpent-4-enoxy]-diphenylsilane |
| SMILES | Cc1ccccc1/C(=C/c1ccccn1)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H37NOSi/c1-27-16-11-12-23-32(27)28(26-29-18-13-14-24-34-29)17-15-25-35-36(33(2,3)4,30-19-7-5-8-20-30)31-21-9-6-10-22-31/h5-14,16,18-24,26H,15,17,25H2,1-4H3/b28-26+ |
| InChIKey | GJGLSQMIGQPYBT-BYCLXTJYSA-N |
| XLogP | 7.29 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.75 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|