C13H20 — CID 142044240
(2Z,4E,6Z,9Z)-4,5-dimethylundeca-2,4,6,9-tetraene (PubChem CID 142044240) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (2Z,4E,6Z,9Z)-4,5-dimethylundeca-2,4,6,9-tetraene.
| Compound Name | (2Z,4E,6Z,9Z)-4,5-dimethylundeca-2,4,6,9-tetraene |
|---|---|
| PubChem CID | 142044240 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (2Z,4E,6Z,9Z)-4,5-dimethylundeca-2,4,6,9-tetraene |
| SMILES | C/C=C\C/C=C\C(C)=C(C)\C=C/C |
| InChI | InChI=1S/C13H20/c1-5-7-8-9-11-13(4)12(3)10-6-2/h5-7,9-11H,8H2,1-4H3/b7-5-,10-6-,11-9-,13-12+ |
| InChIKey | GRYANIUGCMOCBT-BHXABJMWSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|