C26H42 — CID 173482142
1-cyclohexyl-4-[(5Z,7E,9Z)-7,8-dimethyl-3-methylideneundeca-5,7,9-trienyl]cyclohexane (PubChem CID 173482142) has the molecular formula C26H42 and a molecular weight of 354.62 g/mol. Its IUPAC name is 1-cyclohexyl-4-[(5Z,7E,9Z)-7,8-dimethyl-3-methylideneundeca-5,7,9-trienyl]cyclohexane.
| Compound Name | 1-cyclohexyl-4-[(5Z,7E,9Z)-7,8-dimethyl-3-methylideneundeca-5,7,9-trienyl]cyclohexane |
|---|---|
| PubChem CID | 173482142 |
| Molecular Formula | C26H42 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.33 |
| IUPAC Name | 1-cyclohexyl-4-[(5Z,7E,9Z)-7,8-dimethyl-3-methylideneundeca-5,7,9-trienyl]cyclohexane |
| SMILES | C=C(C/C=C\C(C)=C(C)\C=C/C)CCC1CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C26H42/c1-5-10-22(3)23(4)12-9-11-21(2)15-16-24-17-19-26(20-18-24)25-13-7-6-8-14-25/h5,9-10,12,24-26H,2,6-8,11,13-20H2,1,3-4H3/b10-5-,12-9-,23-22+ |
| InChIKey | VUZUTQRBRKKQGM-SAYQNRHFSA-N |
| XLogP | 8.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|