C11H19FO — CID 143613129
ethane;(2Z,4Z,6Z)-1-fluoro-5-methylocta-2,4,6-trien-4-ol (PubChem CID 143613129) has the molecular formula C11H19FO and a molecular weight of 186.27 g/mol. Its IUPAC name is ethane;(2Z,4Z,6Z)-1-fluoro-5-methylocta-2,4,6-trien-4-ol.
| Compound Name | ethane;(2Z,4Z,6Z)-1-fluoro-5-methylocta-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 143613129 |
| Molecular Formula | C11H19FO |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | ethane;(2Z,4Z,6Z)-1-fluoro-5-methylocta-2,4,6-trien-4-ol |
| SMILES | C/C=C\C(C)=C(O)\C=C/CF.CC |
| InChI | InChI=1S/C9H13FO.C2H6/c1-3-5-8(2)9(11)6-4-7-10;1-2/h3-6,11H,7H2,1-2H3;1-2H3/b5-3-,6-4-,9-8-; |
| InChIKey | VQRDJHLBWGEQAK-NVXCOGPVSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|