C12H25NO — CID 170423404
N-methyl-N-(2,2,4,4-tetramethylpentyl)acetamide (PubChem CID 170423404) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is N-methyl-N-(2,2,4,4-tetramethylpentyl)acetamide.
| Compound Name | N-methyl-N-(2,2,4,4-tetramethylpentyl)acetamide |
|---|---|
| PubChem CID | 170423404 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | N-methyl-N-(2,2,4,4-tetramethylpentyl)acetamide |
| SMILES | CC(=O)N(C)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C12H25NO/c1-10(14)13(7)9-12(5,6)8-11(2,3)4/h8-9H2,1-7H3 |
| InChIKey | DVDAIHYCXYXXDP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |