C17H41N3 — CID 145281180
ethane;N'-methyl-N-[methyl(2,2,4,4-tetramethylpentyl)amino]ethanimidamide (PubChem CID 145281180) has the molecular formula C17H41N3 and a molecular weight of 287.54 g/mol. Its IUPAC name is ethane;N'-methyl-N-[methyl(2,2,4,4-tetramethylpentyl)amino]ethanimidamide.
| Compound Name | ethane;N'-methyl-N-[methyl(2,2,4,4-tetramethylpentyl)amino]ethanimidamide |
|---|---|
| PubChem CID | 145281180 |
| Molecular Formula | C17H41N3 |
| Molecular Weight | 287.54 g/mol |
| Exact Mass | 287.33 |
| IUPAC Name | ethane;N'-methyl-N-[methyl(2,2,4,4-tetramethylpentyl)amino]ethanimidamide |
| SMILES | C/N=C(\C)NN(C)CC(C)(C)CC(C)(C)C.CC.CC |
| InChI | InChI=1S/C13H29N3.2C2H6/c1-11(14-7)15-16(8)10-13(5,6)9-12(2,3)4;2*1-2/h9-10H2,1-8H3,(H,14,15);2*1-2H3 |
| InChIKey | KDEZRDGEYNPNRN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|