C9H20O3P+ — CID 130434432
hydroxy-oxo-(2,2,4,4-tetramethylpentoxy)phosphanium (PubChem CID 130434432) has the molecular formula C9H20O3P+ and a molecular weight of 207.23 g/mol. Its IUPAC name is hydroxy-oxo-(2,2,4,4-tetramethylpentoxy)phosphanium.
| Compound Name | hydroxy-oxo-(2,2,4,4-tetramethylpentoxy)phosphanium |
|---|---|
| PubChem CID | 130434432 |
| Molecular Formula | C9H20O3P+ |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | hydroxy-oxo-(2,2,4,4-tetramethylpentoxy)phosphanium |
| SMILES | CC(C)(C)CC(C)(C)CO[P+](=O)O |
| InChI | InChI=1S/C9H19O3P/c1-8(2,3)6-9(4,5)7-12-13(10)11/h6-7H2,1-5H3/p+1 |
| InChIKey | YIABIMJGCBLBAD-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|