C13H21NO2 — CID 129191043
2,2,4,4-tetramethylpentyl 2-cyanoprop-2-enoate (PubChem CID 129191043) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2,2,4,4-tetramethylpentyl 2-cyanoprop-2-enoate.
| Compound Name | 2,2,4,4-tetramethylpentyl 2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 129191043 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 2,2,4,4-tetramethylpentyl 2-cyanoprop-2-enoate |
| SMILES | C=C(C#N)C(=O)OCC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C13H21NO2/c1-10(7-14)11(15)16-9-13(5,6)8-12(2,3)4/h1,8-9H2,2-6H3 |
| InChIKey | JJSBTICCRJHULS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|