About 2-hexoxyethyl 2-cyanoprop-2-enoate
2-hexoxyethyl 2-cyanoprop-2-enoate (PubChem CID 20547382) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-hexoxyethyl 2-cyanoprop-2-enoate.
Molecular Properties
| Compound Name | 2-hexoxyethyl 2-cyanoprop-2-enoate |
| PubChem CID | 20547382 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 2-hexoxyethyl 2-cyanoprop-2-enoate |
| SMILES | C=C(C#N)C(=O)OCCOCCCCCC |
| InChI | InChI=1S/C12H19NO3/c1-3-4-5-6-7-15-8-9-16-12(14)11(2)10-13/h2-9H2,1H3 |
| InChIKey | RGBNYZUANKCQNN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hexoxyethyl 2-cyanoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexoxyethyl 2-cyanoprop-2-enoate?
The IUPAC name of 2-hexoxyethyl 2-cyanoprop-2-enoate (CID 20547382) is 2-hexoxyethyl 2-cyanoprop-2-enoate.
What is the SMILES notation for 2-hexoxyethyl 2-cyanoprop-2-enoate?
The canonical SMILES for 2-hexoxyethyl 2-cyanoprop-2-enoate is C=C(C#N)C(=O)OCCOCCCCCC.
What is the InChIKey of 2-hexoxyethyl 2-cyanoprop-2-enoate?
The InChIKey is RGBNYZUANKCQNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3/c1-3-4-5-6-7-15-8-9-16-12(14)11(2)10-13/h2-9H2,1H3.
What are the key properties of 2-hexoxyethyl 2-cyanoprop-2-enoate?
2-hexoxyethyl 2-cyanoprop-2-enoate has a molecular weight of 225.29 g/mol, XLogP of 2.21, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexoxyethyl 2-cyanoprop-2-enoate is sourced from PubChem (CID 20547382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).