C5H9Br3O3P+ — CID 172748719
[3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium (PubChem CID 172748719) has the molecular formula C5H9Br3O3P+ and a molecular weight of 387.81 g/mol. Its IUPAC name is [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium.
| Compound Name | [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 172748719 |
| Molecular Formula | C5H9Br3O3P+ |
| Molecular Weight | 387.81 g/mol |
| Exact Mass | 384.78 |
| IUPAC Name | [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OCC(CBr)(CBr)CBr |
| InChI | InChI=1S/C5H8Br3O3P/c6-1-5(2-7,3-8)4-11-12(9)10/h1-4H2/p+1 |
| InChIKey | NWVVUYUQCNDPFN-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.81 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|