About [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium
[3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium (PubChem CID 172748719) has the molecular formula C5H9Br3O3P+
and a molecular weight of 387.81 g/mol. Its IUPAC name is [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium.
Molecular Properties
| Compound Name | [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium |
| PubChem CID | 172748719 |
| Molecular Formula | C5H9Br3O3P+ |
| Molecular Weight | 387.81 g/mol |
| Exact Mass | 384.78 |
| IUPAC Name | [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OCC(CBr)(CBr)CBr |
| InChI | InChI=1S/C5H8Br3O3P/c6-1-5(2-7,3-8)4-11-12(9)10/h1-4H2/p+1 |
| InChIKey | NWVVUYUQCNDPFN-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.81 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium?
The IUPAC name of [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium (CID 172748719) is [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium.
What is the SMILES notation for [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium?
The canonical SMILES for [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium is O=[P+](O)OCC(CBr)(CBr)CBr.
What is the InChIKey of [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium?
The InChIKey is NWVVUYUQCNDPFN-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H8Br3O3P/c6-1-5(2-7,3-8)4-11-12(9)10/h1-4H2/p+1.
What are the key properties of [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium?
[3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium has a molecular weight of 387.81 g/mol, XLogP of 2.82, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-bromo-2,2-bis(bromomethyl)propoxy]-hydroxy-oxophosphanium is sourced from PubChem (CID 172748719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).