About 2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine
2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine (PubChem CID 174957638) has the molecular formula C5H14BrNO3P+
and a molecular weight of 247.05 g/mol. Its IUPAC name is 2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine |
| PubChem CID | 174957638 |
| Molecular Formula | C5H14BrNO3P+ |
| Molecular Weight | 247.05 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine |
| SMILES | CN(C)C.O=[P+](O)OCCBr |
| InChI | InChI=1S/C3H9N.C2H4BrO3P/c1-4(2)3;3-1-2-6-7(4)5/h1-3H3;1-2H2/p+1 |
| InChIKey | FUHHLWJNTBYHBH-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.05 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine?
The IUPAC name of 2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine (CID 174957638) is 2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine.
What is the SMILES notation for 2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine?
The canonical SMILES for 2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine is CN(C)C.O=[P+](O)OCCBr.
What is the InChIKey of 2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine?
The InChIKey is FUHHLWJNTBYHBH-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H9N.C2H4BrO3P/c1-4(2)3;3-1-2-6-7(4)5/h1-3H3;1-2H2/p+1.
What are the key properties of 2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine?
2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine has a molecular weight of 247.05 g/mol, XLogP of 1.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethoxy-hydroxy-oxophosphanium;N,N-dimethylmethanamine is sourced from PubChem (CID 174957638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).