About hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+)
hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+) (PubChem CID 173073813) has the molecular formula C5H13O3PRb+
and a molecular weight of 237.60 g/mol. Its IUPAC name is hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+).
Molecular Properties
| Compound Name | hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+) |
| PubChem CID | 173073813 |
| Molecular Formula | C5H13O3PRb+ |
| Molecular Weight | 237.60 g/mol |
| Exact Mass | 236.97 |
| IUPAC Name | hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+) |
| SMILES | CCCCCO[P+](=O)O.[H-].[Rb+] |
| InChI | InChI=1S/C5H11O3P.Rb.H/c1-2-3-4-5-8-9(6)7;;/h2-5H2,1H3;;/q;+1;-1/p+1 |
| InChIKey | YTSIMCMSIBCFMU-UHFFFAOYSA-O |
| XLogP | -1.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.60 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+)?
The IUPAC name of hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+) (CID 173073813) is hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+).
What is the SMILES notation for hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+)?
The canonical SMILES for hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+) is CCCCCO[P+](=O)O.[H-].[Rb+].
What is the InChIKey of hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+)?
The InChIKey is YTSIMCMSIBCFMU-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H11O3P.Rb.H/c1-2-3-4-5-8-9(6)7;;/h2-5H2,1H3;;/q;+1;-1/p+1.
What are the key properties of hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+)?
hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+) has a molecular weight of 237.60 g/mol, XLogP of -1.04, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydride;hydroxy-oxo-pentoxyphosphanium;rubidium(1+) is sourced from PubChem (CID 173073813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).