About alumane;hydroxy-oxo-pentoxyphosphanium
alumane;hydroxy-oxo-pentoxyphosphanium (PubChem CID 175153464) has the molecular formula C5H15AlO3P+
and a molecular weight of 181.13 g/mol. Its IUPAC name is alumane;hydroxy-oxo-pentoxyphosphanium.
Molecular Properties
| Compound Name | alumane;hydroxy-oxo-pentoxyphosphanium |
| PubChem CID | 175153464 |
| Molecular Formula | C5H15AlO3P+ |
| Molecular Weight | 181.13 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | alumane;hydroxy-oxo-pentoxyphosphanium |
| SMILES | CCCCCO[P+](=O)O.[AlH3] |
| InChI | InChI=1S/C5H11O3P.Al.3H/c1-2-3-4-5-8-9(6)7;;;;/h2-5H2,1H3;;;;/p+1 |
| InChIKey | DALAKVAEKZIFOZ-UHFFFAOYSA-O |
| XLogP | 0.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.13 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze alumane;hydroxy-oxo-pentoxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;hydroxy-oxo-pentoxyphosphanium?
The IUPAC name of alumane;hydroxy-oxo-pentoxyphosphanium (CID 175153464) is alumane;hydroxy-oxo-pentoxyphosphanium.
What is the SMILES notation for alumane;hydroxy-oxo-pentoxyphosphanium?
The canonical SMILES for alumane;hydroxy-oxo-pentoxyphosphanium is CCCCCO[P+](=O)O.[AlH3].
What is the InChIKey of alumane;hydroxy-oxo-pentoxyphosphanium?
The InChIKey is DALAKVAEKZIFOZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H11O3P.Al.3H/c1-2-3-4-5-8-9(6)7;;;;/h2-5H2,1H3;;;;/p+1.
What are the key properties of alumane;hydroxy-oxo-pentoxyphosphanium?
alumane;hydroxy-oxo-pentoxyphosphanium has a molecular weight of 181.13 g/mol, XLogP of 0.66, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;hydroxy-oxo-pentoxyphosphanium is sourced from PubChem (CID 175153464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).