About azane;hexoxy-hydroxy-oxophosphanium
azane;hexoxy-hydroxy-oxophosphanium (PubChem CID 174618925) has the molecular formula C6H17NO3P+
and a molecular weight of 182.18 g/mol. Its IUPAC name is azane;hexoxy-hydroxy-oxophosphanium.
Molecular Properties
| Compound Name | azane;hexoxy-hydroxy-oxophosphanium |
| PubChem CID | 174618925 |
| Molecular Formula | C6H17NO3P+ |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | azane;hexoxy-hydroxy-oxophosphanium |
| SMILES | CCCCCCO[P+](=O)O.N |
| InChI | InChI=1S/C6H13O3P.H3N/c1-2-3-4-5-6-9-10(7)8;/h2-6H2,1H3;1H3/p+1 |
| InChIKey | WZJZSVCIUMNMJW-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;hexoxy-hydroxy-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;hexoxy-hydroxy-oxophosphanium?
The IUPAC name of azane;hexoxy-hydroxy-oxophosphanium (CID 174618925) is azane;hexoxy-hydroxy-oxophosphanium.
What is the SMILES notation for azane;hexoxy-hydroxy-oxophosphanium?
The canonical SMILES for azane;hexoxy-hydroxy-oxophosphanium is CCCCCCO[P+](=O)O.N.
What is the InChIKey of azane;hexoxy-hydroxy-oxophosphanium?
The InChIKey is WZJZSVCIUMNMJW-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H13O3P.H3N/c1-2-3-4-5-6-9-10(7)8;/h2-6H2,1H3;1H3/p+1.
What are the key properties of azane;hexoxy-hydroxy-oxophosphanium?
azane;hexoxy-hydroxy-oxophosphanium has a molecular weight of 182.18 g/mol, XLogP of 2.39, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;hexoxy-hydroxy-oxophosphanium is sourced from PubChem (CID 174618925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).