About dipotassium;butoxy-hydroxy-oxophosphanium;hydride
dipotassium;butoxy-hydroxy-oxophosphanium;hydride (PubChem CID 173240292) has the molecular formula C4H12K2O3P+
and a molecular weight of 217.31 g/mol. Its IUPAC name is dipotassium;butoxy-hydroxy-oxophosphanium;hydride.
Molecular Properties
| Compound Name | dipotassium;butoxy-hydroxy-oxophosphanium;hydride |
| PubChem CID | 173240292 |
| Molecular Formula | C4H12K2O3P+ |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 216.98 |
| IUPAC Name | dipotassium;butoxy-hydroxy-oxophosphanium;hydride |
| SMILES | CCCCO[P+](=O)O.[H-].[H-].[K+].[K+] |
| InChI | InChI=1S/C4H9O3P.2K.2H/c1-2-3-4-7-8(5)6;;;;/h2-4H2,1H3;;;;/q;2*+1;2*-1/p+1 |
| InChIKey | PMCKXAFMXZRAEB-UHFFFAOYSA-O |
| XLogP | -4.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | -4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;butoxy-hydroxy-oxophosphanium;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;butoxy-hydroxy-oxophosphanium;hydride?
The IUPAC name of dipotassium;butoxy-hydroxy-oxophosphanium;hydride (CID 173240292) is dipotassium;butoxy-hydroxy-oxophosphanium;hydride.
What is the SMILES notation for dipotassium;butoxy-hydroxy-oxophosphanium;hydride?
The canonical SMILES for dipotassium;butoxy-hydroxy-oxophosphanium;hydride is CCCCO[P+](=O)O.[H-].[H-].[K+].[K+].
What is the InChIKey of dipotassium;butoxy-hydroxy-oxophosphanium;hydride?
The InChIKey is PMCKXAFMXZRAEB-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H9O3P.2K.2H/c1-2-3-4-7-8(5)6;;;;/h2-4H2,1H3;;;;/q;2*+1;2*-1/p+1.
What are the key properties of dipotassium;butoxy-hydroxy-oxophosphanium;hydride?
dipotassium;butoxy-hydroxy-oxophosphanium;hydride has a molecular weight of 217.31 g/mol, XLogP of -4.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;butoxy-hydroxy-oxophosphanium;hydride is sourced from PubChem (CID 173240292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).