About CID 131882023
CID 131882023 (PubChem CID 131882023) has the molecular formula C18H36KO3P+
and a molecular weight of 370.56 g/mol.
Molecular Properties
| Compound Name | CID 131882023 |
| PubChem CID | 131882023 |
| Molecular Formula | C18H36KO3P+ |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | — |
| SMILES | CCCCCCCC/C=C\CCCCCCCCO[P+](=O)O.[K] |
| InChI | InChI=1S/C18H35O3P.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-22(19)20;/h9-10H,2-8,11-18H2,1H3;/p+1/b10-9-; |
| InChIKey | ADPDRBDYQPCFNZ-KVVVOXFISA-O |
| XLogP | 6.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 131882023 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131882023?
The IUPAC name of CID 131882023 (CID 131882023) is not available.
What is the SMILES notation for CID 131882023?
The canonical SMILES for CID 131882023 is CCCCCCCC/C=C\CCCCCCCCO[P+](=O)O.[K].
What is the InChIKey of CID 131882023?
The InChIKey is ADPDRBDYQPCFNZ-KVVVOXFISA-O. The full InChI is InChI=1S/C18H35O3P.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-22(19)20;/h9-10H,2-8,11-18H2,1H3;/p+1/b10-9-;.
What are the key properties of CID 131882023?
CID 131882023 has a molecular weight of 370.56 g/mol, XLogP of 6.31, 17 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131882023 is sourced from PubChem (CID 131882023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).