About dihydroxy(oxo)phosphanium;octadec-9-enylazanium
dihydroxy(oxo)phosphanium;octadec-9-enylazanium (PubChem CID 57351234) has the molecular formula C18H40NO3P+2
and a molecular weight of 349.50 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;octadec-9-enylazanium.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;octadec-9-enylazanium |
| PubChem CID | 57351234 |
| Molecular Formula | C18H40NO3P+2 |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | dihydroxy(oxo)phosphanium;octadec-9-enylazanium |
| SMILES | CCCCCCCCC=CCCCCCCCC[NH3+].O=[P+](O)O |
| InChI | InChI=1S/C18H37N.HO3P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-4(2)3/h9-10H,2-8,11-19H2,1H3;(H-,1,2,3)/p+2 |
| InChIKey | DECDSLJTLJDXFN-UHFFFAOYSA-P |
| XLogP | 4.89 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;octadec-9-enylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;octadec-9-enylazanium?
The IUPAC name of dihydroxy(oxo)phosphanium;octadec-9-enylazanium (CID 57351234) is dihydroxy(oxo)phosphanium;octadec-9-enylazanium.
What is the SMILES notation for dihydroxy(oxo)phosphanium;octadec-9-enylazanium?
The canonical SMILES for dihydroxy(oxo)phosphanium;octadec-9-enylazanium is CCCCCCCCC=CCCCCCCCC[NH3+].O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;octadec-9-enylazanium?
The InChIKey is DECDSLJTLJDXFN-UHFFFAOYSA-P. The full InChI is InChI=1S/C18H37N.HO3P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-4(2)3/h9-10H,2-8,11-19H2,1H3;(H-,1,2,3)/p+2.
What are the key properties of dihydroxy(oxo)phosphanium;octadec-9-enylazanium?
dihydroxy(oxo)phosphanium;octadec-9-enylazanium has a molecular weight of 349.50 g/mol, XLogP of 4.89, 15 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;octadec-9-enylazanium is sourced from PubChem (CID 57351234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).