About azane;hydroxy-(hydroxymethoxy)-oxophosphanium
azane;hydroxy-(hydroxymethoxy)-oxophosphanium (PubChem CID 175032722) has the molecular formula CH7NO4P+
and a molecular weight of 128.04 g/mol. Its IUPAC name is azane;hydroxy-(hydroxymethoxy)-oxophosphanium.
Molecular Properties
| Compound Name | azane;hydroxy-(hydroxymethoxy)-oxophosphanium |
| PubChem CID | 175032722 |
| Molecular Formula | CH7NO4P+ |
| Molecular Weight | 128.04 g/mol |
| Exact Mass | 128.01 |
| IUPAC Name | azane;hydroxy-(hydroxymethoxy)-oxophosphanium |
| SMILES | N.O=[P+](O)OCO |
| InChI | InChI=1S/CH3O4P.H3N/c2-1-5-6(3)4;/h2H,1H2;1H3/p+1 |
| InChIKey | SJELNMALTAYYSS-UHFFFAOYSA-O |
| XLogP | -0.24 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.04 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;hydroxy-(hydroxymethoxy)-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;hydroxy-(hydroxymethoxy)-oxophosphanium?
The IUPAC name of azane;hydroxy-(hydroxymethoxy)-oxophosphanium (CID 175032722) is azane;hydroxy-(hydroxymethoxy)-oxophosphanium.
What is the SMILES notation for azane;hydroxy-(hydroxymethoxy)-oxophosphanium?
The canonical SMILES for azane;hydroxy-(hydroxymethoxy)-oxophosphanium is N.O=[P+](O)OCO.
What is the InChIKey of azane;hydroxy-(hydroxymethoxy)-oxophosphanium?
The InChIKey is SJELNMALTAYYSS-UHFFFAOYSA-O. The full InChI is InChI=1S/CH3O4P.H3N/c2-1-5-6(3)4;/h2H,1H2;1H3/p+1.
What are the key properties of azane;hydroxy-(hydroxymethoxy)-oxophosphanium?
azane;hydroxy-(hydroxymethoxy)-oxophosphanium has a molecular weight of 128.04 g/mol, XLogP of -0.24, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;hydroxy-(hydroxymethoxy)-oxophosphanium is sourced from PubChem (CID 175032722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).