C7H14O6P+ — CID 175510991
2,2-dimethylpropoxycarbonyloxymethoxy-hydroxy-oxophosphanium (PubChem CID 175510991) has the molecular formula C7H14O6P+ and a molecular weight of 225.16 g/mol. Its IUPAC name is 2,2-dimethylpropoxycarbonyloxymethoxy-hydroxy-oxophosphanium.
| Compound Name | 2,2-dimethylpropoxycarbonyloxymethoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 175510991 |
| Molecular Formula | C7H14O6P+ |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 2,2-dimethylpropoxycarbonyloxymethoxy-hydroxy-oxophosphanium |
| SMILES | CC(C)(C)COC(=O)OCO[P+](=O)O |
| InChI | InChI=1S/C7H13O6P/c1-7(2,3)4-11-6(8)12-5-13-14(9)10/h4-5H2,1-3H3/p+1 |
| InChIKey | HTMDUNURGUIXNX-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|