C8H18N2 — CID 143394266
ethane;N-ethenyl-N,N'-dimethylethanimidamide (PubChem CID 143394266) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is ethane;N-ethenyl-N,N'-dimethylethanimidamide.
| Compound Name | ethane;N-ethenyl-N,N'-dimethylethanimidamide |
|---|---|
| PubChem CID | 143394266 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | ethane;N-ethenyl-N,N'-dimethylethanimidamide |
| SMILES | C=CN(C)/C(C)=N/C.CC |
| InChI | InChI=1S/C6H12N2.C2H6/c1-5-8(4)6(2)7-3;1-2/h5H,1H2,2-4H3;1-2H3/b7-6+; |
| InChIKey | VIWMSUNCFDGSSI-UHDJGPCESA-N |
| XLogP | 2.14 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|