About ethane;1-ethenyl-1,2,3-trimethylguanidine
ethane;1-ethenyl-1,2,3-trimethylguanidine (PubChem CID 170952169) has the molecular formula C10H25N3
and a molecular weight of 187.33 g/mol. Its IUPAC name is ethane;1-ethenyl-1,2,3-trimethylguanidine.
Molecular Properties
| Compound Name | ethane;1-ethenyl-1,2,3-trimethylguanidine |
| PubChem CID | 170952169 |
| Molecular Formula | C10H25N3 |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.20 |
| IUPAC Name | ethane;1-ethenyl-1,2,3-trimethylguanidine |
| SMILES | C=CN(C)/C(=N\C)NC.CC.CC |
| InChI | InChI=1S/C6H13N3.2C2H6/c1-5-9(4)6(7-2)8-3;2*1-2/h5H,1H2,2-4H3,(H,7,8);2*1-2H3 |
| InChIKey | GBMROGKLILJEFQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethenyl-1,2,3-trimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethenyl-1,2,3-trimethylguanidine?
The IUPAC name of ethane;1-ethenyl-1,2,3-trimethylguanidine (CID 170952169) is ethane;1-ethenyl-1,2,3-trimethylguanidine.
What is the SMILES notation for ethane;1-ethenyl-1,2,3-trimethylguanidine?
The canonical SMILES for ethane;1-ethenyl-1,2,3-trimethylguanidine is C=CN(C)/C(=N\C)NC.CC.CC.
What is the InChIKey of ethane;1-ethenyl-1,2,3-trimethylguanidine?
The InChIKey is GBMROGKLILJEFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3.2C2H6/c1-5-9(4)6(7-2)8-3;2*1-2/h5H,1H2,2-4H3,(H,7,8);2*1-2H3.
What are the key properties of ethane;1-ethenyl-1,2,3-trimethylguanidine?
ethane;1-ethenyl-1,2,3-trimethylguanidine has a molecular weight of 187.33 g/mol, XLogP of 2.32, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethenyl-1,2,3-trimethylguanidine is sourced from PubChem (CID 170952169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).