C8H19N3 — CID 131223275
1-ethyl-2,3-dimethyl-1-propylguanidine (PubChem CID 131223275) has the molecular formula C8H19N3 and a molecular weight of 157.26 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethyl-1-propylguanidine.
| Compound Name | 1-ethyl-2,3-dimethyl-1-propylguanidine |
|---|---|
| PubChem CID | 131223275 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | 1-ethyl-2,3-dimethyl-1-propylguanidine |
| SMILES | CCCN(CC)/C(=N/C)NC |
| InChI | InChI=1S/C8H19N3/c1-5-7-11(6-2)8(9-3)10-4/h5-7H2,1-4H3,(H,9,10) |
| InChIKey | HSNOLCUGZSYZTQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|