C9H21N3 — CID 62359189
1-ethyl-1,2-dipropylguanidine (PubChem CID 62359189) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is 1-ethyl-1,2-dipropylguanidine.
| Compound Name | 1-ethyl-1,2-dipropylguanidine |
|---|---|
| PubChem CID | 62359189 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 1-ethyl-1,2-dipropylguanidine |
| SMILES | CCC/N=C(\N)N(CC)CCC |
| InChI | InChI=1S/C9H21N3/c1-4-7-11-9(10)12(6-3)8-5-2/h4-8H2,1-3H3,(H2,10,11) |
| InChIKey | RJWUYZSZQSBDMN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|