C11H26N4 — CID 111022676
2-[2-(diethylamino)ethyl]-1,1-diethylguanidine (PubChem CID 111022676) has the molecular formula C11H26N4 and a molecular weight of 214.36 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethyl]-1,1-diethylguanidine.
| Compound Name | 2-[2-(diethylamino)ethyl]-1,1-diethylguanidine |
|---|---|
| PubChem CID | 111022676 |
| Molecular Formula | C11H26N4 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.22 |
| IUPAC Name | 2-[2-(diethylamino)ethyl]-1,1-diethylguanidine |
| SMILES | CCN(CC)CC/N=C(\N)N(CC)CC |
| InChI | InChI=1S/C11H26N4/c1-5-14(6-2)10-9-13-11(12)15(7-3)8-4/h5-10H2,1-4H3,(H2,12,13) |
| InChIKey | OVOPOMCFEUGPAW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|