C14H29N3 — CID 111062808
2-(3-cyclohexylpropyl)-1,1-diethylguanidine (PubChem CID 111062808) has the molecular formula C14H29N3 and a molecular weight of 239.41 g/mol. Its IUPAC name is 2-(3-cyclohexylpropyl)-1,1-diethylguanidine.
| Compound Name | 2-(3-cyclohexylpropyl)-1,1-diethylguanidine |
|---|---|
| PubChem CID | 111062808 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | 2-(3-cyclohexylpropyl)-1,1-diethylguanidine |
| SMILES | CCN(CC)/C(N)=N/CCCC1CCCCC1 |
| InChI | InChI=1S/C14H29N3/c1-3-17(4-2)14(15)16-12-8-11-13-9-6-5-7-10-13/h13H,3-12H2,1-2H3,(H2,15,16) |
| InChIKey | KNVQZONWLMTOEF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|