C10H20F3N3O — CID 111057684
1,1-diethyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 111057684) has the molecular formula C10H20F3N3O and a molecular weight of 255.28 g/mol. Its IUPAC name is 1,1-diethyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 1,1-diethyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111057684 |
| Molecular Formula | C10H20F3N3O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1,1-diethyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | CCN(CC)/C(N)=N/CCCOCC(F)(F)F |
| InChI | InChI=1S/C10H20F3N3O/c1-3-16(4-2)9(14)15-6-5-7-17-8-10(11,12)13/h3-8H2,1-2H3,(H2,14,15) |
| InChIKey | LGRKDVVJUFCLAG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|