C9H22N4O2S — CID 111062569
1,1-diethyl-2-[2-(ethylsulfonylamino)ethyl]guanidine (PubChem CID 111062569) has the molecular formula C9H22N4O2S and a molecular weight of 250.37 g/mol. Its IUPAC name is 1,1-diethyl-2-[2-(ethylsulfonylamino)ethyl]guanidine.
| Compound Name | 1,1-diethyl-2-[2-(ethylsulfonylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 111062569 |
| Molecular Formula | C9H22N4O2S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1,1-diethyl-2-[2-(ethylsulfonylamino)ethyl]guanidine |
| SMILES | CCN(CC)/C(N)=N/CCNS(=O)(=O)CC |
| InChI | InChI=1S/C9H22N4O2S/c1-4-13(5-2)9(10)11-7-8-12-16(14,15)6-3/h12H,4-8H2,1-3H3,(H2,10,11) |
| InChIKey | BQBBJWJMFSUYHQ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|