C6H13CaN3O3 — CID 87562233
calcium;1,1,2,3-tetramethylguanidine;carbonate (PubChem CID 87562233) has the molecular formula C6H13CaN3O3 and a molecular weight of 215.27 g/mol. Its IUPAC name is calcium;1,1,2,3-tetramethylguanidine;carbonate.
| Compound Name | calcium;1,1,2,3-tetramethylguanidine;carbonate |
|---|---|
| PubChem CID | 87562233 |
| Molecular Formula | C6H13CaN3O3 |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | calcium;1,1,2,3-tetramethylguanidine;carbonate |
| SMILES | C/N=C(/NC)N(C)C.O=C([O-])[O-].[Ca+2] |
| InChI | InChI=1S/C5H13N3.CH2O3.Ca/c1-6-5(7-2)8(3)4;2-1(3)4;/h1-4H3,(H,6,7);(H2,2,3,4);/q;;+2/p-2 |
| InChIKey | OTGXCSZKQPQGOK-UHFFFAOYSA-L |
| XLogP | -3.07 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|