C5H12N4O — CID 163885409
(N,N,N'-trimethylcarbamimidoyl)urea (PubChem CID 163885409) has the molecular formula C5H12N4O and a molecular weight of 144.18 g/mol. Its IUPAC name is (N,N,N'-trimethylcarbamimidoyl)urea.
| Compound Name | (N,N,N'-trimethylcarbamimidoyl)urea |
|---|---|
| PubChem CID | 163885409 |
| Molecular Formula | C5H12N4O |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | (N,N,N'-trimethylcarbamimidoyl)urea |
| SMILES | C/N=C(/NC(N)=O)N(C)C |
| InChI | InChI=1S/C5H12N4O/c1-7-5(9(2)3)8-4(6)10/h1-3H3,(H3,6,7,8,10) |
| InChIKey | PWXBSWLERHAIDM-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|